C24H43F2N7O2 — CID 138645864
3,3-diamino-2-(3-ethyl-6-fluoro-3-methylazepan-2-yl)-N-[5-fluoro-4-(4-oxo-1,3,6,7,8,8a-hexahydropyrrolo[1,2-a]pyrazin-2-yl)piperidin-3-yl]propanamide (PubChem CID 138645864) has the molecular formula C24H43F2N7O2 and a molecular weight of 499.65 g/mol. Its IUPAC name is 3,3-diamino-2-(3-ethyl-6-fluoro-3-methylazepan-2-yl)-N-[5-fluoro-4-(4-oxo-1,3,6,7,8,8a-hexahydropyrrolo[1,2-a]pyrazin-2-yl)piperidin-3-yl]propanamide.
| Compound Name | 3,3-diamino-2-(3-ethyl-6-fluoro-3-methylazepan-2-yl)-N-[5-fluoro-4-(4-oxo-1,3,6,7,8,8a-hexahydropyrrolo[1,2-a]pyrazin-2-yl)piperidin-3-yl]propanamide |
|---|---|
| PubChem CID | 138645864 |
| Molecular Formula | C24H43F2N7O2 |
| Molecular Weight | 499.65 g/mol |
| Exact Mass | 499.34 |
| IUPAC Name | 3,3-diamino-2-(3-ethyl-6-fluoro-3-methylazepan-2-yl)-N-[5-fluoro-4-(4-oxo-1,3,6,7,8,8a-hexahydropyrrolo[1,2-a]pyrazin-2-yl)piperidin-3-yl]propanamide |
| SMILES | CCC1(C)CCC(F)CNC1C(C(=O)NC1CNCC(F)C1N1CC(=O)N2CCCC2C1)C(N)N |
| InChI | InChI=1S/C24H43F2N7O2/c1-3-24(2)7-6-14(25)9-30-21(24)19(22(27)28)23(35)31-17-11-29-10-16(26)20(17)32-12-15-5-4-8-33(15)18(34)13-32/h14-17,19-22,29-30H,3-13,27-28H2,1-2H3,(H,31,35) |
| InChIKey | YYQFNKPFDYMRTI-UHFFFAOYSA-N |
| XLogP | -0.55 |
| TPSA | 128.75 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.65 |
| LogP ≤ 5 | -0.55 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|