C21H32N4O3 — CID 134321946
tert-butyl 4-[4-(3-aminopiperidin-4-yl)benzoyl]piperazine-1-carboxylate (PubChem CID 134321946) has the molecular formula C21H32N4O3 and a molecular weight of 388.51 g/mol. Its IUPAC name is tert-butyl 4-[4-(3-aminopiperidin-4-yl)benzoyl]piperazine-1-carboxylate.
| Compound Name | tert-butyl 4-[4-(3-aminopiperidin-4-yl)benzoyl]piperazine-1-carboxylate |
|---|---|
| PubChem CID | 134321946 |
| Molecular Formula | C21H32N4O3 |
| Molecular Weight | 388.51 g/mol |
| Exact Mass | 388.25 |
| IUPAC Name | tert-butyl 4-[4-(3-aminopiperidin-4-yl)benzoyl]piperazine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCN(C(=O)c2ccc(C3CCNCC3N)cc2)CC1 |
| InChI | InChI=1S/C21H32N4O3/c1-21(2,3)28-20(27)25-12-10-24(11-13-25)19(26)16-6-4-15(5-7-16)17-8-9-23-14-18(17)22/h4-7,17-18,23H,8-14,22H2,1-3H3 |
| InChIKey | BQRYMSHTJXLXTO-UHFFFAOYSA-N |
| XLogP | 1.78 |
| TPSA | 87.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.51 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |