C30H26F4N4O5 — CID 134327364
2-[(3R)-6-(5-carbamoyliminocyclohexa-1,3-dien-1-yl)-2',4'-dioxospiro[1,2-dihydroindene-3,5'-1,3-oxazolidine]-3'-yl]-N-[(4-fluorophenyl)methyl]-N-(1,1,1-trifluoropropan-2-yl)acetamide (PubChem CID 134327364) has the molecular formula C30H26F4N4O5 and a molecular weight of 598.55 g/mol. Its IUPAC name is 2-[(3R)-6-(5-carbamoyliminocyclohexa-1,3-dien-1-yl)-2',4'-dioxospiro[1,2-dihydroindene-3,5'-1,3-oxazolidine]-3'-yl]-N-[(4-fluorophenyl)methyl]-N-(1,1,1-trifluoropropan-2-yl)acetamide.
| Compound Name | 2-[(3R)-6-(5-carbamoyliminocyclohexa-1,3-dien-1-yl)-2',4'-dioxospiro[1,2-dihydroindene-3,5'-1,3-oxazolidine]-3'-yl]-N-[(4-fluorophenyl)methyl]-N-(1,1,1-trifluoropropan-2-yl)acetamide |
|---|---|
| PubChem CID | 134327364 |
| Molecular Formula | C30H26F4N4O5 |
| Molecular Weight | 598.55 g/mol |
| Exact Mass | 598.18 |
| IUPAC Name | 2-[(3R)-6-(5-carbamoyliminocyclohexa-1,3-dien-1-yl)-2',4'-dioxospiro[1,2-dihydroindene-3,5'-1,3-oxazolidine]-3'-yl]-N-[(4-fluorophenyl)methyl]-N-(1,1,1-trifluoropropan-2-yl)acetamide |
| SMILES | CC(N(Cc1ccc(F)cc1)C(=O)CN1C(=O)O[C@@]2(CCc3cc(C4=CC=CC(=NC(N)=O)C4)ccc32)C1=O)C(F)(F)F |
| InChI | InChI=1S/C30H26F4N4O5/c1-17(30(32,33)34)37(15-18-5-8-22(31)9-6-18)25(39)16-38-26(40)29(43-28(38)42)12-11-21-13-20(7-10-24(21)29)19-3-2-4-23(14-19)36-27(35)41/h2-10,13,17H,11-12,14-16H2,1H3,(H2,35,41)/t17?,29-/m1/s1 |
| InChIKey | DKWWHEIIRKBOAD-SNIQBREISA-N |
| XLogP | 4.79 |
| TPSA | 122.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 598.55 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|