C17H11ClFIN2O2 — CID 1343287
3-(2-chloro-6-fluorophenyl)-N-(2-iodophenyl)-5-methyl-1,2-oxazole-4-carboxamide (PubChem CID 1343287) has the molecular formula C17H11ClFIN2O2 and a molecular weight of 456.64 g/mol. Its IUPAC name is 3-(2-chloro-6-fluorophenyl)-N-(2-iodophenyl)-5-methyl-1,2-oxazole-4-carboxamide.
| Compound Name | 3-(2-chloro-6-fluorophenyl)-N-(2-iodophenyl)-5-methyl-1,2-oxazole-4-carboxamide |
|---|---|
| PubChem CID | 1343287 |
| Molecular Formula | C17H11ClFIN2O2 |
| Molecular Weight | 456.64 g/mol |
| Exact Mass | 455.95 |
| IUPAC Name | 3-(2-chloro-6-fluorophenyl)-N-(2-iodophenyl)-5-methyl-1,2-oxazole-4-carboxamide |
| SMILES | Cc1onc(-c2c(F)cccc2Cl)c1C(=O)Nc1ccccc1I |
| InChI | InChI=1S/C17H11ClFIN2O2/c1-9-14(17(23)21-13-8-3-2-7-12(13)20)16(22-24-9)15-10(18)5-4-6-11(15)19/h2-8H,1H3,(H,21,23) |
| InChIKey | RBRVZGXRJWLOOE-UHFFFAOYSA-N |
| XLogP | 5.30 |
| TPSA | 55.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.64 |
| LogP ≤ 5 | 5.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|