C21H20ClN3O2S — CID 2809351
3-(2-chlorophenyl)-5-methyl-N-[(4-propan-2-ylphenyl)carbamothioyl]-1,2-oxazole-4-carboxamide (PubChem CID 2809351) has the molecular formula C21H20ClN3O2S and a molecular weight of 413.93 g/mol. Its IUPAC name is 3-(2-chlorophenyl)-5-methyl-N-[(4-propan-2-ylphenyl)carbamothioyl]-1,2-oxazole-4-carboxamide.
| Compound Name | 3-(2-chlorophenyl)-5-methyl-N-[(4-propan-2-ylphenyl)carbamothioyl]-1,2-oxazole-4-carboxamide |
|---|---|
| PubChem CID | 2809351 |
| Molecular Formula | C21H20ClN3O2S |
| Molecular Weight | 413.93 g/mol |
| Exact Mass | 413.10 |
| IUPAC Name | 3-(2-chlorophenyl)-5-methyl-N-[(4-propan-2-ylphenyl)carbamothioyl]-1,2-oxazole-4-carboxamide |
| SMILES | Cc1onc(-c2ccccc2Cl)c1C(=O)NC(=S)Nc1ccc(C(C)C)cc1 |
| InChI | InChI=1S/C21H20ClN3O2S/c1-12(2)14-8-10-15(11-9-14)23-21(28)24-20(26)18-13(3)27-25-19(18)16-6-4-5-7-17(16)22/h4-12H,1-3H3,(H2,23,24,26,28) |
| InChIKey | DVJMLMRBXHEUAR-UHFFFAOYSA-N |
| XLogP | 5.55 |
| TPSA | 67.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.93 |
| LogP ≤ 5 | 5.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|