C11H18N2O5 — CID 134329092
2-hydroxy-4-[[2-methyl-2-(prop-2-enoylamino)propanoyl]amino]butanoic acid (PubChem CID 134329092) has the molecular formula C11H18N2O5 and a molecular weight of 258.27 g/mol. Its IUPAC name is 2-hydroxy-4-[[2-methyl-2-(prop-2-enoylamino)propanoyl]amino]butanoic acid.
| Compound Name | 2-hydroxy-4-[[2-methyl-2-(prop-2-enoylamino)propanoyl]amino]butanoic acid |
|---|---|
| PubChem CID | 134329092 |
| Molecular Formula | C11H18N2O5 |
| Molecular Weight | 258.27 g/mol |
| Exact Mass | 258.12 |
| IUPAC Name | 2-hydroxy-4-[[2-methyl-2-(prop-2-enoylamino)propanoyl]amino]butanoic acid |
| SMILES | C=CC(=O)NC(C)(C)C(=O)NCCC(O)C(=O)O |
| InChI | InChI=1S/C11H18N2O5/c1-4-8(15)13-11(2,3)10(18)12-6-5-7(14)9(16)17/h4,7,14H,1,5-6H2,2-3H3,(H,12,18)(H,13,15)(H,16,17) |
| InChIKey | YLVHTCAVOFJKDW-UHFFFAOYSA-N |
| XLogP | -0.98 |
| TPSA | 115.73 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.27 |
| LogP ≤ 5 | -0.98 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|