C11H19N2NaO4 — CID 175046256
sodium;hydride;4-[[2-methyl-2-(prop-2-enoylamino)propanoyl]amino]butanoic acid (PubChem CID 175046256) has the molecular formula C11H19N2NaO4 and a molecular weight of 266.27 g/mol. Its IUPAC name is sodium;hydride;4-[[2-methyl-2-(prop-2-enoylamino)propanoyl]amino]butanoic acid.
| Compound Name | sodium;hydride;4-[[2-methyl-2-(prop-2-enoylamino)propanoyl]amino]butanoic acid |
|---|---|
| PubChem CID | 175046256 |
| Molecular Formula | C11H19N2NaO4 |
| Molecular Weight | 266.27 g/mol |
| Exact Mass | 266.12 |
| IUPAC Name | sodium;hydride;4-[[2-methyl-2-(prop-2-enoylamino)propanoyl]amino]butanoic acid |
| SMILES | C=CC(=O)NC(C)(C)C(=O)NCCCC(=O)O.[H-].[Na+] |
| InChI | InChI=1S/C11H18N2O4.Na.H/c1-4-8(14)13-11(2,3)10(17)12-7-5-6-9(15)16;;/h4H,1,5-7H2,2-3H3,(H,12,17)(H,13,14)(H,15,16);;/q;+1;-1 |
| InChIKey | YWJHEBRWHQILNO-UHFFFAOYSA-N |
| XLogP | -2.84 |
| TPSA | 95.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.27 |
| LogP ≤ 5 | -2.84 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|