C18H40N6O6S — CID 140596521
diaminomethylidene-[4-[[2-methyl-2-(prop-2-enoylamino)propanoyl]amino]butyl]azanium;triethylazanium;sulfate (PubChem CID 140596521) has the molecular formula C18H40N6O6S and a molecular weight of 468.62 g/mol. Its IUPAC name is diaminomethylidene-[4-[[2-methyl-2-(prop-2-enoylamino)propanoyl]amino]butyl]azanium;triethylazanium;sulfate.
| Compound Name | diaminomethylidene-[4-[[2-methyl-2-(prop-2-enoylamino)propanoyl]amino]butyl]azanium;triethylazanium;sulfate |
|---|---|
| PubChem CID | 140596521 |
| Molecular Formula | C18H40N6O6S |
| Molecular Weight | 468.62 g/mol |
| Exact Mass | 468.27 |
| IUPAC Name | diaminomethylidene-[4-[[2-methyl-2-(prop-2-enoylamino)propanoyl]amino]butyl]azanium;triethylazanium;sulfate |
| SMILES | C=CC(=O)NC(C)(C)C(=O)NCCCC[NH+]=C(N)N.CC[NH+](CC)CC.O=S(=O)([O-])[O-] |
| InChI | InChI=1S/C12H23N5O2.C6H15N.H2O4S/c1-4-9(18)17-12(2,3)10(19)15-7-5-6-8-16-11(13)14;1-4-7(5-2)6-3;1-5(2,3)4/h4H,1,5-8H2,2-3H3,(H,15,19)(H,17,18)(H4,13,14,16);4-6H2,1-3H3;(H2,1,2,3,4) |
| InChIKey | WCCBULIXUNMTTG-UHFFFAOYSA-N |
| XLogP | -4.09 |
| TPSA | 208.91 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.62 |
| LogP ≤ 5 | -4.09 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|