C9H13NO — CID 13433062
3,4,5,6-tetramethyl-1H-pyridin-2-one (PubChem CID 13433062) has the molecular formula C9H13NO and a molecular weight of 151.21 g/mol. Its IUPAC name is 3,4,5,6-tetramethyl-1H-pyridin-2-one.
| Compound Name | 3,4,5,6-tetramethyl-1H-pyridin-2-one |
|---|---|
| PubChem CID | 13433062 |
| Molecular Formula | C9H13NO |
| Molecular Weight | 151.21 g/mol |
| Exact Mass | 151.10 |
| IUPAC Name | 3,4,5,6-tetramethyl-1H-pyridin-2-one |
| SMILES | Cc1[nH]c(=O)c(C)c(C)c1C |
| InChI | InChI=1S/C9H13NO/c1-5-6(2)8(4)10-9(11)7(5)3/h1-4H3,(H,10,11) |
| InChIKey | SVRMGDULMMTCIL-UHFFFAOYSA-N |
| XLogP | 1.61 |
| TPSA | 32.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 151.21 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |