C9H10N2O — CID 13433094
1,5,6-trimethyl-2-oxopyridine-3-carbonitrile (PubChem CID 13433094) has the molecular formula C9H10N2O and a molecular weight of 162.19 g/mol. Its IUPAC name is 1,5,6-trimethyl-2-oxopyridine-3-carbonitrile.
| Compound Name | 1,5,6-trimethyl-2-oxopyridine-3-carbonitrile |
|---|---|
| PubChem CID | 13433094 |
| Molecular Formula | C9H10N2O |
| Molecular Weight | 162.19 g/mol |
| Exact Mass | 162.08 |
| IUPAC Name | 1,5,6-trimethyl-2-oxopyridine-3-carbonitrile |
| SMILES | Cc1cc(C#N)c(=O)n(C)c1C |
| InChI | InChI=1S/C9H10N2O/c1-6-4-8(5-10)9(12)11(3)7(6)2/h4H,1-3H3 |
| InChIKey | DDBCNRDQPFYGIP-UHFFFAOYSA-N |
| XLogP | 0.87 |
| TPSA | 45.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 162.19 |
| LogP ≤ 5 | 0.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |