C12H17F3N2O — CID 134331678
3-[5-propan-2-yl-3-(trifluoromethyl)pyrazol-1-yl]cyclopentan-1-ol (PubChem CID 134331678) has the molecular formula C12H17F3N2O and a molecular weight of 262.27 g/mol. Its IUPAC name is 3-[5-propan-2-yl-3-(trifluoromethyl)pyrazol-1-yl]cyclopentan-1-ol.
| Compound Name | 3-[5-propan-2-yl-3-(trifluoromethyl)pyrazol-1-yl]cyclopentan-1-ol |
|---|---|
| PubChem CID | 134331678 |
| Molecular Formula | C12H17F3N2O |
| Molecular Weight | 262.27 g/mol |
| Exact Mass | 262.13 |
| IUPAC Name | 3-[5-propan-2-yl-3-(trifluoromethyl)pyrazol-1-yl]cyclopentan-1-ol |
| SMILES | CC(C)c1cc(C(F)(F)F)nn1C1CCC(O)C1 |
| InChI | InChI=1S/C12H17F3N2O/c1-7(2)10-6-11(12(13,14)15)16-17(10)8-3-4-9(18)5-8/h6-9,18H,3-5H2,1-2H3 |
| InChIKey | QOZVWDOLEZXFTH-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.27 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |