C14H24N2O4 — CID 134339654
methyl 6-[[2-methyl-2-(prop-2-enoylamino)propanoyl]amino]hexanoate (PubChem CID 134339654) has the molecular formula C14H24N2O4 and a molecular weight of 284.36 g/mol. Its IUPAC name is methyl 6-[[2-methyl-2-(prop-2-enoylamino)propanoyl]amino]hexanoate.
| Compound Name | methyl 6-[[2-methyl-2-(prop-2-enoylamino)propanoyl]amino]hexanoate |
|---|---|
| PubChem CID | 134339654 |
| Molecular Formula | C14H24N2O4 |
| Molecular Weight | 284.36 g/mol |
| Exact Mass | 284.17 |
| IUPAC Name | methyl 6-[[2-methyl-2-(prop-2-enoylamino)propanoyl]amino]hexanoate |
| SMILES | C=CC(=O)NC(C)(C)C(=O)NCCCCCC(=O)OC |
| InChI | InChI=1S/C14H24N2O4/c1-5-11(17)16-14(2,3)13(19)15-10-8-6-7-9-12(18)20-4/h5H,1,6-10H2,2-4H3,(H,15,19)(H,16,17) |
| InChIKey | ACEIFHZZEJWENV-UHFFFAOYSA-N |
| XLogP | 0.92 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.36 |
| LogP ≤ 5 | 0.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|