C13H21FN2O4 — CID 134339657
fluoro 6-[[2-methyl-2-(prop-2-enoylamino)propanoyl]amino]hexanoate (PubChem CID 134339657) has the molecular formula C13H21FN2O4 and a molecular weight of 288.32 g/mol. Its IUPAC name is fluoro 6-[[2-methyl-2-(prop-2-enoylamino)propanoyl]amino]hexanoate.
| Compound Name | fluoro 6-[[2-methyl-2-(prop-2-enoylamino)propanoyl]amino]hexanoate |
|---|---|
| PubChem CID | 134339657 |
| Molecular Formula | C13H21FN2O4 |
| Molecular Weight | 288.32 g/mol |
| Exact Mass | 288.15 |
| IUPAC Name | fluoro 6-[[2-methyl-2-(prop-2-enoylamino)propanoyl]amino]hexanoate |
| SMILES | C=CC(=O)NC(C)(C)C(=O)NCCCCCC(=O)OF |
| InChI | InChI=1S/C13H21FN2O4/c1-4-10(17)16-13(2,3)12(19)15-9-7-5-6-8-11(18)20-14/h4H,1,5-9H2,2-3H3,(H,15,19)(H,16,17) |
| InChIKey | WQRLQKWHINEZCZ-UHFFFAOYSA-N |
| XLogP | 1.17 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.32 |
| LogP ≤ 5 | 1.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|