C16H29N7O2 — CID 134339667
2-amino-6-(cyanomethyl)-N-(4-methoxy-1-methylpiperidin-3-yl)-1,2,3,3a,4,5,6,7-octahydropyrazolo[1,5-a]pyrimidine-3-carboxamide (PubChem CID 134339667) has the molecular formula C16H29N7O2 and a molecular weight of 351.46 g/mol. Its IUPAC name is 2-amino-6-(cyanomethyl)-N-(4-methoxy-1-methylpiperidin-3-yl)-1,2,3,3a,4,5,6,7-octahydropyrazolo[1,5-a]pyrimidine-3-carboxamide.
| Compound Name | 2-amino-6-(cyanomethyl)-N-(4-methoxy-1-methylpiperidin-3-yl)-1,2,3,3a,4,5,6,7-octahydropyrazolo[1,5-a]pyrimidine-3-carboxamide |
|---|---|
| PubChem CID | 134339667 |
| Molecular Formula | C16H29N7O2 |
| Molecular Weight | 351.46 g/mol |
| Exact Mass | 351.24 |
| IUPAC Name | 2-amino-6-(cyanomethyl)-N-(4-methoxy-1-methylpiperidin-3-yl)-1,2,3,3a,4,5,6,7-octahydropyrazolo[1,5-a]pyrimidine-3-carboxamide |
| SMILES | COC1CCN(C)CC1NC(=O)C1C(N)NN2CC(CC#N)CNC12 |
| InChI | InChI=1S/C16H29N7O2/c1-22-6-4-12(25-2)11(9-22)20-16(24)13-14(18)21-23-8-10(3-5-17)7-19-15(13)23/h10-15,19,21H,3-4,6-9,18H2,1-2H3,(H,20,24) |
| InChIKey | POTRIFCZKZMPRE-UHFFFAOYSA-N |
| XLogP | -2.00 |
| TPSA | 118.68 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.46 |
| LogP ≤ 5 | -2.00 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |