C14H20F6O4 — CID 134342932
[1-(1,1,1,3,3,3-hexafluoropropan-2-yloxy)-1-oxopropan-2-yl] 2,2,4-trimethylpentanoate (PubChem CID 134342932) has the molecular formula C14H20F6O4 and a molecular weight of 366.30 g/mol. Its IUPAC name is [1-(1,1,1,3,3,3-hexafluoropropan-2-yloxy)-1-oxopropan-2-yl] 2,2,4-trimethylpentanoate.
| Compound Name | [1-(1,1,1,3,3,3-hexafluoropropan-2-yloxy)-1-oxopropan-2-yl] 2,2,4-trimethylpentanoate |
|---|---|
| PubChem CID | 134342932 |
| Molecular Formula | C14H20F6O4 |
| Molecular Weight | 366.30 g/mol |
| Exact Mass | 366.13 |
| IUPAC Name | [1-(1,1,1,3,3,3-hexafluoropropan-2-yloxy)-1-oxopropan-2-yl] 2,2,4-trimethylpentanoate |
| SMILES | CC(C)CC(C)(C)C(=O)OC(C)C(=O)OC(C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C14H20F6O4/c1-7(2)6-12(4,5)11(22)23-8(3)9(21)24-10(13(15,16)17)14(18,19)20/h7-8,10H,6H2,1-5H3 |
| InChIKey | SLCVYZUKUCMROX-UHFFFAOYSA-N |
| XLogP | 4.03 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.30 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |