C8H10ClNO3S — CID 134343363
2-chloro-N-[(2S)-2-hydroxypropoxy]thiophene-3-carboxamide (PubChem CID 134343363) has the molecular formula C8H10ClNO3S and a molecular weight of 235.69 g/mol. Its IUPAC name is 2-chloro-N-[(2S)-2-hydroxypropoxy]thiophene-3-carboxamide.
| Compound Name | 2-chloro-N-[(2S)-2-hydroxypropoxy]thiophene-3-carboxamide |
|---|---|
| PubChem CID | 134343363 |
| Molecular Formula | C8H10ClNO3S |
| Molecular Weight | 235.69 g/mol |
| Exact Mass | 235.01 |
| IUPAC Name | 2-chloro-N-[(2S)-2-hydroxypropoxy]thiophene-3-carboxamide |
| SMILES | C[C@H](O)CONC(=O)c1ccsc1Cl |
| InChI | InChI=1S/C8H10ClNO3S/c1-5(11)4-13-10-8(12)6-2-3-14-7(6)9/h2-3,5,11H,4H2,1H3,(H,10,12)/t5-/m0/s1 |
| InChIKey | FKSRUBYVVYJOSD-YFKPBYRVSA-N |
| XLogP | 1.44 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.69 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|