C17H13F3N2O4 — CID 134348700
[8-[(3,4,5-trifluorophenyl)carbamoyl]-3,4-dihydro-2H-chromen-4-yl]carbamic acid (PubChem CID 134348700) has the molecular formula C17H13F3N2O4 and a molecular weight of 366.30 g/mol. Its IUPAC name is [8-[(3,4,5-trifluorophenyl)carbamoyl]-3,4-dihydro-2H-chromen-4-yl]carbamic acid.
| Compound Name | [8-[(3,4,5-trifluorophenyl)carbamoyl]-3,4-dihydro-2H-chromen-4-yl]carbamic acid |
|---|---|
| PubChem CID | 134348700 |
| Molecular Formula | C17H13F3N2O4 |
| Molecular Weight | 366.30 g/mol |
| Exact Mass | 366.08 |
| IUPAC Name | [8-[(3,4,5-trifluorophenyl)carbamoyl]-3,4-dihydro-2H-chromen-4-yl]carbamic acid |
| SMILES | O=C(O)NC1CCOc2c(C(=O)Nc3cc(F)c(F)c(F)c3)cccc21 |
| InChI | InChI=1S/C17H13F3N2O4/c18-11-6-8(7-12(19)14(11)20)21-16(23)10-3-1-2-9-13(22-17(24)25)4-5-26-15(9)10/h1-3,6-7,13,22H,4-5H2,(H,21,23)(H,24,25) |
| InChIKey | LGRYROIBNBFJGW-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 87.66 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.30 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|