C21H22F2N2O5 — CID 139340331
3-methoxypropyl N-[(4S)-8-[(3,4-difluorophenyl)carbamoyl]-3,4-dihydro-2H-chromen-4-yl]carbamate (PubChem CID 139340331) has the molecular formula C21H22F2N2O5 and a molecular weight of 420.41 g/mol. Its IUPAC name is 3-methoxypropyl N-[(4S)-8-[(3,4-difluorophenyl)carbamoyl]-3,4-dihydro-2H-chromen-4-yl]carbamate.
| Compound Name | 3-methoxypropyl N-[(4S)-8-[(3,4-difluorophenyl)carbamoyl]-3,4-dihydro-2H-chromen-4-yl]carbamate |
|---|---|
| PubChem CID | 139340331 |
| Molecular Formula | C21H22F2N2O5 |
| Molecular Weight | 420.41 g/mol |
| Exact Mass | 420.15 |
| IUPAC Name | 3-methoxypropyl N-[(4S)-8-[(3,4-difluorophenyl)carbamoyl]-3,4-dihydro-2H-chromen-4-yl]carbamate |
| SMILES | COCCCOC(=O)N[C@H]1CCOc2c(C(=O)Nc3ccc(F)c(F)c3)cccc21 |
| InChI | InChI=1S/C21H22F2N2O5/c1-28-9-3-10-30-21(27)25-18-8-11-29-19-14(18)4-2-5-15(19)20(26)24-13-6-7-16(22)17(23)12-13/h2,4-7,12,18H,3,8-11H2,1H3,(H,24,26)(H,25,27)/t18-/m0/s1 |
| InChIKey | IAUPHIYLOJGPCW-SFHVURJKSA-N |
| XLogP | 3.80 |
| TPSA | 85.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.41 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|