C21H23ClN2O4 — CID 134349810
N-[4-(7-chloro-3,4-dihydro-1H-isoquinolin-2-yl)-3-hydroxy-4-oxobutan-2-yl]-N-(2-methoxyphenyl)formamide (PubChem CID 134349810) has the molecular formula C21H23ClN2O4 and a molecular weight of 402.88 g/mol. Its IUPAC name is N-[4-(7-chloro-3,4-dihydro-1H-isoquinolin-2-yl)-3-hydroxy-4-oxobutan-2-yl]-N-(2-methoxyphenyl)formamide.
| Compound Name | N-[4-(7-chloro-3,4-dihydro-1H-isoquinolin-2-yl)-3-hydroxy-4-oxobutan-2-yl]-N-(2-methoxyphenyl)formamide |
|---|---|
| PubChem CID | 134349810 |
| Molecular Formula | C21H23ClN2O4 |
| Molecular Weight | 402.88 g/mol |
| Exact Mass | 402.13 |
| IUPAC Name | N-[4-(7-chloro-3,4-dihydro-1H-isoquinolin-2-yl)-3-hydroxy-4-oxobutan-2-yl]-N-(2-methoxyphenyl)formamide |
| SMILES | COc1ccccc1N(C=O)C(C)C(O)C(=O)N1CCc2ccc(Cl)cc2C1 |
| InChI | InChI=1S/C21H23ClN2O4/c1-14(24(13-25)18-5-3-4-6-19(18)28-2)20(26)21(27)23-10-9-15-7-8-17(22)11-16(15)12-23/h3-8,11,13-14,20,26H,9-10,12H2,1-2H3 |
| InChIKey | YBPIPINQZIQXDL-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 70.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.88 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|