C13H16ClNO4 — CID 20848097
2-(5-chloro-N-formyl-2-methoxyanilino)-3-methylbutanoic acid (PubChem CID 20848097) has the molecular formula C13H16ClNO4 and a molecular weight of 285.73 g/mol. Its IUPAC name is 2-(5-chloro-N-formyl-2-methoxyanilino)-3-methylbutanoic acid.
| Compound Name | 2-(5-chloro-N-formyl-2-methoxyanilino)-3-methylbutanoic acid |
|---|---|
| PubChem CID | 20848097 |
| Molecular Formula | C13H16ClNO4 |
| Molecular Weight | 285.73 g/mol |
| Exact Mass | 285.08 |
| IUPAC Name | 2-(5-chloro-N-formyl-2-methoxyanilino)-3-methylbutanoic acid |
| SMILES | COc1ccc(Cl)cc1N(C=O)C(C(=O)O)C(C)C |
| InChI | InChI=1S/C13H16ClNO4/c1-8(2)12(13(17)18)15(7-16)10-6-9(14)4-5-11(10)19-3/h4-8,12H,1-3H3,(H,17,18) |
| InChIKey | UGUGNVPZBIEOTD-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 66.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.73 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|