About N'-(5-chloro-2-methoxyphenyl)-N'-methylmethanediamine
N'-(5-chloro-2-methoxyphenyl)-N'-methylmethanediamine (PubChem CID 115225518) has the molecular formula C9H13ClN2O
and a molecular weight of 200.67 g/mol. Its IUPAC name is N'-(5-chloro-2-methoxyphenyl)-N'-methylmethanediamine.
Molecular Properties
| Compound Name | N'-(5-chloro-2-methoxyphenyl)-N'-methylmethanediamine |
| PubChem CID | 115225518 |
| Molecular Formula | C9H13ClN2O |
| Molecular Weight | 200.67 g/mol |
| Exact Mass | 200.07 |
| IUPAC Name | N'-(5-chloro-2-methoxyphenyl)-N'-methylmethanediamine |
| SMILES | COc1ccc(Cl)cc1N(C)CN |
| InChI | InChI=1S/C9H13ClN2O/c1-12(6-11)8-5-7(10)3-4-9(8)13-2/h3-5H,6,11H2,1-2H3 |
| InChIKey | YKOAJVJAHRJGFW-UHFFFAOYSA-N |
| XLogP | 1.70 |
| TPSA | 38.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 200.67 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze N'-(5-chloro-2-methoxyphenyl)-N'-methylmethanediamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N'-(5-chloro-2-methoxyphenyl)-N'-methylmethanediamine?
The IUPAC name of N'-(5-chloro-2-methoxyphenyl)-N'-methylmethanediamine (CID 115225518) is N'-(5-chloro-2-methoxyphenyl)-N'-methylmethanediamine.
What is the SMILES notation for N'-(5-chloro-2-methoxyphenyl)-N'-methylmethanediamine?
The canonical SMILES for N'-(5-chloro-2-methoxyphenyl)-N'-methylmethanediamine is COc1ccc(Cl)cc1N(C)CN.
What is the InChIKey of N'-(5-chloro-2-methoxyphenyl)-N'-methylmethanediamine?
The InChIKey is YKOAJVJAHRJGFW-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H13ClN2O/c1-12(6-11)8-5-7(10)3-4-9(8)13-2/h3-5H,6,11H2,1-2H3.
What are the key properties of N'-(5-chloro-2-methoxyphenyl)-N'-methylmethanediamine?
N'-(5-chloro-2-methoxyphenyl)-N'-methylmethanediamine has a molecular weight of 200.67 g/mol, XLogP of 1.70, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N'-(5-chloro-2-methoxyphenyl)-N'-methylmethanediamine is sourced from PubChem (CID 115225518), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).