C11H17ClN2O — CID 28772873
N'-(5-chloro-2-methoxyphenyl)-N'-ethylethane-1,2-diamine (PubChem CID 28772873) has the molecular formula C11H17ClN2O and a molecular weight of 228.72 g/mol. Its IUPAC name is N'-(5-chloro-2-methoxyphenyl)-N'-ethylethane-1,2-diamine.
| Compound Name | N'-(5-chloro-2-methoxyphenyl)-N'-ethylethane-1,2-diamine |
|---|---|
| PubChem CID | 28772873 |
| Molecular Formula | C11H17ClN2O |
| Molecular Weight | 228.72 g/mol |
| Exact Mass | 228.10 |
| IUPAC Name | N'-(5-chloro-2-methoxyphenyl)-N'-ethylethane-1,2-diamine |
| SMILES | CCN(CCN)c1cc(Cl)ccc1OC |
| InChI | InChI=1S/C11H17ClN2O/c1-3-14(7-6-13)10-8-9(12)4-5-11(10)15-2/h4-5,8H,3,6-7,13H2,1-2H3 |
| InChIKey | ACQSCQHJRNBHQP-UHFFFAOYSA-N |
| XLogP | 2.13 |
| TPSA | 38.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.72 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |