C22H23N5O3 — CID 134350742
2-[1-(3-azidopropyl)-2,3-dihydroxy-5-methyl-2H-indol-3-yl]-1-(1H-indol-3-yl)ethanone (PubChem CID 134350742) has the molecular formula C22H23N5O3 and a molecular weight of 405.46 g/mol. Its IUPAC name is 2-[1-(3-azidopropyl)-2,3-dihydroxy-5-methyl-2H-indol-3-yl]-1-(1H-indol-3-yl)ethanone.
| Compound Name | 2-[1-(3-azidopropyl)-2,3-dihydroxy-5-methyl-2H-indol-3-yl]-1-(1H-indol-3-yl)ethanone |
|---|---|
| PubChem CID | 134350742 |
| Molecular Formula | C22H23N5O3 |
| Molecular Weight | 405.46 g/mol |
| Exact Mass | 405.18 |
| IUPAC Name | 2-[1-(3-azidopropyl)-2,3-dihydroxy-5-methyl-2H-indol-3-yl]-1-(1H-indol-3-yl)ethanone |
| SMILES | Cc1ccc2c(c1)C(O)(CC(=O)c1c[nH]c3ccccc13)C(O)N2CCCN=[N+]=[N-] |
| InChI | InChI=1S/C22H23N5O3/c1-14-7-8-19-17(11-14)22(30,21(29)27(19)10-4-9-25-26-23)12-20(28)16-13-24-18-6-3-2-5-15(16)18/h2-3,5-8,11,13,21,24,29-30H,4,9-10,12H2,1H3 |
| InChIKey | WWWYPUUXOPEPKA-UHFFFAOYSA-N |
| XLogP | 3.78 |
| TPSA | 125.32 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.46 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|