C20H26N2 — CID 134353176
2-(4-methylphenyl)-5-(4-propylcyclohexyl)pyrimidine (PubChem CID 134353176) has the molecular formula C20H26N2 and a molecular weight of 294.44 g/mol. Its IUPAC name is 2-(4-methylphenyl)-5-(4-propylcyclohexyl)pyrimidine.
| Compound Name | 2-(4-methylphenyl)-5-(4-propylcyclohexyl)pyrimidine |
|---|---|
| PubChem CID | 134353176 |
| Molecular Formula | C20H26N2 |
| Molecular Weight | 294.44 g/mol |
| Exact Mass | 294.21 |
| IUPAC Name | 2-(4-methylphenyl)-5-(4-propylcyclohexyl)pyrimidine |
| SMILES | CCCC1CCC(c2cnc(-c3ccc(C)cc3)nc2)CC1 |
| InChI | InChI=1S/C20H26N2/c1-3-4-16-7-11-17(12-8-16)19-13-21-20(22-14-19)18-9-5-15(2)6-10-18/h5-6,9-10,13-14,16-17H,3-4,7-8,11-12H2,1-2H3 |
| InChIKey | MGJABWDGOQSBPT-UHFFFAOYSA-N |
| XLogP | 5.53 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.44 |
| LogP ≤ 5 | 5.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |