C24H26N2 — CID 59982558
5-(4-methylcyclohexyl)-2-[4-(4-methylphenyl)phenyl]pyrimidine (PubChem CID 59982558) has the molecular formula C24H26N2 and a molecular weight of 342.49 g/mol. Its IUPAC name is 5-(4-methylcyclohexyl)-2-[4-(4-methylphenyl)phenyl]pyrimidine.
| Compound Name | 5-(4-methylcyclohexyl)-2-[4-(4-methylphenyl)phenyl]pyrimidine |
|---|---|
| PubChem CID | 59982558 |
| Molecular Formula | C24H26N2 |
| Molecular Weight | 342.49 g/mol |
| Exact Mass | 342.21 |
| IUPAC Name | 5-(4-methylcyclohexyl)-2-[4-(4-methylphenyl)phenyl]pyrimidine |
| SMILES | Cc1ccc(-c2ccc(-c3ncc(C4CCC(C)CC4)cn3)cc2)cc1 |
| InChI | InChI=1S/C24H26N2/c1-17-3-7-19(8-4-17)20-11-13-22(14-12-20)24-25-15-23(16-26-24)21-9-5-18(2)6-10-21/h3-4,7-8,11-16,18,21H,5-6,9-10H2,1-2H3 |
| InChIKey | LUZVOOBUHJHNDS-UHFFFAOYSA-N |
| XLogP | 6.41 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.49 |
| LogP ≤ 5 | 6.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |