C34H54N6O6 — CID 134353548
(4R,10R,13S)-12,31-dimethyl-4-(2-methylpropyl)-13-propan-2-yl-27-oxa-3,6,12,15,24,30-hexazatricyclo[26.4.0.06,10]dotriaconta-1(28),29,31-triene-2,5,11,14,25-pentone (PubChem CID 134353548) has the molecular formula C34H54N6O6 and a molecular weight of 642.84 g/mol. Its IUPAC name is (4R,10R,13S)-12,31-dimethyl-4-(2-methylpropyl)-13-propan-2-yl-27-oxa-3,6,12,15,24,30-hexazatricyclo[26.4.0.06,10]dotriaconta-1(28),29,31-triene-2,5,11,14,25-pentone.
| Compound Name | (4R,10R,13S)-12,31-dimethyl-4-(2-methylpropyl)-13-propan-2-yl-27-oxa-3,6,12,15,24,30-hexazatricyclo[26.4.0.06,10]dotriaconta-1(28),29,31-triene-2,5,11,14,25-pentone |
|---|---|
| PubChem CID | 134353548 |
| Molecular Formula | C34H54N6O6 |
| Molecular Weight | 642.84 g/mol |
| Exact Mass | 642.41 |
| IUPAC Name | (4R,10R,13S)-12,31-dimethyl-4-(2-methylpropyl)-13-propan-2-yl-27-oxa-3,6,12,15,24,30-hexazatricyclo[26.4.0.06,10]dotriaconta-1(28),29,31-triene-2,5,11,14,25-pentone |
| SMILES | Cc1cc2c(cn1)OCC(=O)NCCCCCCCCNC(=O)[C@H](C(C)C)N(C)C(=O)[C@H]1CCCN1C(=O)[C@@H](CC(C)C)NC2=O |
| InChI | InChI=1S/C34H54N6O6/c1-22(2)18-26-33(44)40-17-13-14-27(40)34(45)39(6)30(23(3)4)32(43)36-16-12-10-8-7-9-11-15-35-29(41)21-46-28-20-37-24(5)19-25(28)31(42)38-26/h19-20,22-23,26-27,30H,7-18,21H2,1-6H3,(H,35,41)(H,36,43)(H,38,42)/t26-,27-,30+/m1/s1 |
| InChIKey | UAALJRBMJXONBC-ZKKGZRQESA-N |
| XLogP | 2.97 |
| TPSA | 150.04 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 46 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 642.84 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |