C39H57F2N7O5 — CID 142307253
(25Z)-24,26-diamino-8,31-difluoro-12-methyl-4-(2-methylpropyl)-28-oxa-3,6,12,15,24-pentazatricyclo[27.4.0.06,10]tritriaconta-1(29),25,30,32-tetraene-2,5,11,14-tetrone;toluene (PubChem CID 142307253) has the molecular formula C39H57F2N7O5 and a molecular weight of 741.93 g/mol. Its IUPAC name is (25Z)-24,26-diamino-8,31-difluoro-12-methyl-4-(2-methylpropyl)-28-oxa-3,6,12,15,24-pentazatricyclo[27.4.0.06,10]tritriaconta-1(29),25,30,32-tetraene-2,5,11,14-tetrone;toluene.
| Compound Name | (25Z)-24,26-diamino-8,31-difluoro-12-methyl-4-(2-methylpropyl)-28-oxa-3,6,12,15,24-pentazatricyclo[27.4.0.06,10]tritriaconta-1(29),25,30,32-tetraene-2,5,11,14-tetrone;toluene |
|---|---|
| PubChem CID | 142307253 |
| Molecular Formula | C39H57F2N7O5 |
| Molecular Weight | 741.93 g/mol |
| Exact Mass | 741.44 |
| IUPAC Name | (25Z)-24,26-diamino-8,31-difluoro-12-methyl-4-(2-methylpropyl)-28-oxa-3,6,12,15,24-pentazatricyclo[27.4.0.06,10]tritriaconta-1(29),25,30,32-tetraene-2,5,11,14-tetrone;toluene |
| SMILES | CC(C)CC1NC(=O)c2ccc(F)cc2OC/C(N)=C/N(N)CCCCCCCCNC(=O)CN(C)C(=O)C2CC(F)CN2C1=O.Cc1ccccc1 |
| InChI | InChI=1S/C32H49F2N7O5.C7H8/c1-21(2)14-26-31(44)41-17-23(34)15-27(41)32(45)39(3)19-29(42)37-12-8-6-4-5-7-9-13-40(36)18-24(35)20-46-28-16-22(33)10-11-25(28)30(43)38-26;1-7-5-3-2-4-6-7/h10-11,16,18,21,23,26-27H,4-9,12-15,17,19-20,35-36H2,1-3H3,(H,37,42)(H,38,43);2-6H,1H3/b24-18-; |
| InChIKey | VATIGWIIZSCMBL-XWASNXTISA-N |
| XLogP | 4.19 |
| TPSA | 163.33 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 53 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 741.93 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'} |
|---|