C22H29N7O2 — CID 134356350
6-[[8-(4-ethyl-4-hydroxypiperidin-1-yl)-[1,2,4]triazolo[1,5-a]pyrazin-2-yl]amino]-3,3-dimethyl-1,2-dihydroindol-2-ol (PubChem CID 134356350) has the molecular formula C22H29N7O2 and a molecular weight of 423.52 g/mol. Its IUPAC name is 6-[[8-(4-ethyl-4-hydroxypiperidin-1-yl)-[1,2,4]triazolo[1,5-a]pyrazin-2-yl]amino]-3,3-dimethyl-1,2-dihydroindol-2-ol.
| Compound Name | 6-[[8-(4-ethyl-4-hydroxypiperidin-1-yl)-[1,2,4]triazolo[1,5-a]pyrazin-2-yl]amino]-3,3-dimethyl-1,2-dihydroindol-2-ol |
|---|---|
| PubChem CID | 134356350 |
| Molecular Formula | C22H29N7O2 |
| Molecular Weight | 423.52 g/mol |
| Exact Mass | 423.24 |
| IUPAC Name | 6-[[8-(4-ethyl-4-hydroxypiperidin-1-yl)-[1,2,4]triazolo[1,5-a]pyrazin-2-yl]amino]-3,3-dimethyl-1,2-dihydroindol-2-ol |
| SMILES | CCC1(O)CCN(c2nccn3nc(Nc4ccc5c(c4)NC(O)C5(C)C)nc23)CC1 |
| InChI | InChI=1S/C22H29N7O2/c1-4-22(31)7-10-28(11-8-22)17-18-26-20(27-29(18)12-9-23-17)24-14-5-6-15-16(13-14)25-19(30)21(15,2)3/h5-6,9,12-13,19,25,30-31H,4,7-8,10-11H2,1-3H3,(H,24,27) |
| InChIKey | OPOVPQNUDQCONV-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 110.84 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.52 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |