C20H23IN2O3 — CID 134356839
[2-amino-4-(3-iodopropoxy)-5-methoxyphenyl]-[(2R)-2-methyl-2,3-dihydroindol-1-yl]methanone (PubChem CID 134356839) has the molecular formula C20H23IN2O3 and a molecular weight of 466.32 g/mol. Its IUPAC name is [2-amino-4-(3-iodopropoxy)-5-methoxyphenyl]-[(2R)-2-methyl-2,3-dihydroindol-1-yl]methanone.
| Compound Name | [2-amino-4-(3-iodopropoxy)-5-methoxyphenyl]-[(2R)-2-methyl-2,3-dihydroindol-1-yl]methanone |
|---|---|
| PubChem CID | 134356839 |
| Molecular Formula | C20H23IN2O3 |
| Molecular Weight | 466.32 g/mol |
| Exact Mass | 466.08 |
| IUPAC Name | [2-amino-4-(3-iodopropoxy)-5-methoxyphenyl]-[(2R)-2-methyl-2,3-dihydroindol-1-yl]methanone |
| SMILES | COc1cc(C(=O)N2c3ccccc3C[C@H]2C)c(N)cc1OCCCI |
| InChI | InChI=1S/C20H23IN2O3/c1-13-10-14-6-3-4-7-17(14)23(13)20(24)15-11-18(25-2)19(12-16(15)22)26-9-5-8-21/h3-4,6-7,11-13H,5,8-10,22H2,1-2H3/t13-/m1/s1 |
| InChIKey | PJKGUZZLWTUZOJ-CYBMUJFWSA-N |
| XLogP | 4.07 |
| TPSA | 64.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.32 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|