C22H26N6O3 — CID 134357091
2-(6-cyclopropyl-5,7-dioxo-3,4-dihydro-2H-pyrrolo[3,4-b]pyridin-1-yl)-N-[(1E,3Z)-1,4-diamino-4-(6-methyl-3-pyridinyl)buta-1,3-dienyl]acetamide (PubChem CID 134357091) has the molecular formula C22H26N6O3 and a molecular weight of 422.49 g/mol. Its IUPAC name is 2-(6-cyclopropyl-5,7-dioxo-3,4-dihydro-2H-pyrrolo[3,4-b]pyridin-1-yl)-N-[(1E,3Z)-1,4-diamino-4-(6-methyl-3-pyridinyl)buta-1,3-dienyl]acetamide.
| Compound Name | 2-(6-cyclopropyl-5,7-dioxo-3,4-dihydro-2H-pyrrolo[3,4-b]pyridin-1-yl)-N-[(1E,3Z)-1,4-diamino-4-(6-methyl-3-pyridinyl)buta-1,3-dienyl]acetamide |
|---|---|
| PubChem CID | 134357091 |
| Molecular Formula | C22H26N6O3 |
| Molecular Weight | 422.49 g/mol |
| Exact Mass | 422.21 |
| IUPAC Name | 2-(6-cyclopropyl-5,7-dioxo-3,4-dihydro-2H-pyrrolo[3,4-b]pyridin-1-yl)-N-[(1E,3Z)-1,4-diamino-4-(6-methyl-3-pyridinyl)buta-1,3-dienyl]acetamide |
| SMILES | Cc1ccc(/C(N)=C/C=C(\N)NC(=O)CN2CCCC3=C2C(=O)N(C2CC2)C3=O)cn1 |
| InChI | InChI=1S/C22H26N6O3/c1-13-4-5-14(11-25-13)17(23)8-9-18(24)26-19(29)12-27-10-2-3-16-20(27)22(31)28(21(16)30)15-6-7-15/h4-5,8-9,11,15H,2-3,6-7,10,12,23-24H2,1H3,(H,26,29)/b17-8-,18-9+ |
| InChIKey | RAJZMCUMOUYDEC-IADIARBNSA-N |
| XLogP | 0.49 |
| TPSA | 134.65 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.49 |
| LogP ≤ 5 | 0.49 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|