C21H24N6O3 — CID 134357094
2-(6-cyclopropyl-5,7-dioxo-3,4-dihydro-2H-pyrrolo[3,4-b]pyridin-1-yl)-N-[(1E,3Z)-1,4-diamino-4-pyridin-3-ylbuta-1,3-dienyl]acetamide (PubChem CID 134357094) has the molecular formula C21H24N6O3 and a molecular weight of 408.46 g/mol. Its IUPAC name is 2-(6-cyclopropyl-5,7-dioxo-3,4-dihydro-2H-pyrrolo[3,4-b]pyridin-1-yl)-N-[(1E,3Z)-1,4-diamino-4-pyridin-3-ylbuta-1,3-dienyl]acetamide.
| Compound Name | 2-(6-cyclopropyl-5,7-dioxo-3,4-dihydro-2H-pyrrolo[3,4-b]pyridin-1-yl)-N-[(1E,3Z)-1,4-diamino-4-pyridin-3-ylbuta-1,3-dienyl]acetamide |
|---|---|
| PubChem CID | 134357094 |
| Molecular Formula | C21H24N6O3 |
| Molecular Weight | 408.46 g/mol |
| Exact Mass | 408.19 |
| IUPAC Name | 2-(6-cyclopropyl-5,7-dioxo-3,4-dihydro-2H-pyrrolo[3,4-b]pyridin-1-yl)-N-[(1E,3Z)-1,4-diamino-4-pyridin-3-ylbuta-1,3-dienyl]acetamide |
| SMILES | N/C(=C\C=C(/N)NC(=O)CN1CCCC2=C1C(=O)N(C1CC1)C2=O)c1cccnc1 |
| InChI | InChI=1S/C21H24N6O3/c22-16(13-3-1-9-24-11-13)7-8-17(23)25-18(28)12-26-10-2-4-15-19(26)21(30)27(20(15)29)14-5-6-14/h1,3,7-9,11,14H,2,4-6,10,12,22-23H2,(H,25,28)/b16-7-,17-8+ |
| InChIKey | DAYWWJYGJAFVSA-NIVQCIBKSA-N |
| XLogP | 0.18 |
| TPSA | 134.65 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.46 |
| LogP ≤ 5 | 0.18 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|