C26H22N6O4S — CID 178101046
6-(2,6-dioxopiperidin-3-yl)-1-[[3-(3-pyridin-3-ylphenyl)-1,2,4-thiadiazol-5-yl]methyl]-3,4-dihydro-2H-pyrrolo[3,4-b]pyridine-5,7-dione (PubChem CID 178101046) has the molecular formula C26H22N6O4S and a molecular weight of 514.57 g/mol. Its IUPAC name is 6-(2,6-dioxopiperidin-3-yl)-1-[[3-(3-pyridin-3-ylphenyl)-1,2,4-thiadiazol-5-yl]methyl]-3,4-dihydro-2H-pyrrolo[3,4-b]pyridine-5,7-dione.
| Compound Name | 6-(2,6-dioxopiperidin-3-yl)-1-[[3-(3-pyridin-3-ylphenyl)-1,2,4-thiadiazol-5-yl]methyl]-3,4-dihydro-2H-pyrrolo[3,4-b]pyridine-5,7-dione |
|---|---|
| PubChem CID | 178101046 |
| Molecular Formula | C26H22N6O4S |
| Molecular Weight | 514.57 g/mol |
| Exact Mass | 514.14 |
| IUPAC Name | 6-(2,6-dioxopiperidin-3-yl)-1-[[3-(3-pyridin-3-ylphenyl)-1,2,4-thiadiazol-5-yl]methyl]-3,4-dihydro-2H-pyrrolo[3,4-b]pyridine-5,7-dione |
| SMILES | O=C1CCC(N2C(=O)C3=C(C2=O)N(Cc2nc(-c4cccc(-c5cccnc5)c4)ns2)CCC3)C(=O)N1 |
| InChI | InChI=1S/C26H22N6O4S/c33-20-9-8-19(24(34)28-20)32-25(35)18-7-3-11-31(22(18)26(32)36)14-21-29-23(30-37-21)16-5-1-4-15(12-16)17-6-2-10-27-13-17/h1-2,4-6,10,12-13,19H,3,7-9,11,14H2,(H,28,33,34) |
| InChIKey | DYLLNZWNWKDGBD-UHFFFAOYSA-N |
| XLogP | 2.29 |
| TPSA | 125.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.57 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|