C25H20ClN7O5 — CID 178100884
1-[[3-(2-chloro-3-pyrimidin-2-ylphenyl)-1,2,4-oxadiazol-5-yl]methyl]-6-(2,6-dioxopiperidin-3-yl)-3,4-dihydro-2H-pyrrolo[3,4-b]pyridine-5,7-dione (PubChem CID 178100884) has the molecular formula C25H20ClN7O5 and a molecular weight of 533.93 g/mol. Its IUPAC name is 1-[[3-(2-chloro-3-pyrimidin-2-ylphenyl)-1,2,4-oxadiazol-5-yl]methyl]-6-(2,6-dioxopiperidin-3-yl)-3,4-dihydro-2H-pyrrolo[3,4-b]pyridine-5,7-dione.
| Compound Name | 1-[[3-(2-chloro-3-pyrimidin-2-ylphenyl)-1,2,4-oxadiazol-5-yl]methyl]-6-(2,6-dioxopiperidin-3-yl)-3,4-dihydro-2H-pyrrolo[3,4-b]pyridine-5,7-dione |
|---|---|
| PubChem CID | 178100884 |
| Molecular Formula | C25H20ClN7O5 |
| Molecular Weight | 533.93 g/mol |
| Exact Mass | 533.12 |
| IUPAC Name | 1-[[3-(2-chloro-3-pyrimidin-2-ylphenyl)-1,2,4-oxadiazol-5-yl]methyl]-6-(2,6-dioxopiperidin-3-yl)-3,4-dihydro-2H-pyrrolo[3,4-b]pyridine-5,7-dione |
| SMILES | O=C1CCC(N2C(=O)C3=C(C2=O)N(Cc2nc(-c4cccc(-c5ncccn5)c4Cl)no2)CCC3)C(=O)N1 |
| InChI | InChI=1S/C25H20ClN7O5/c26-19-13(21-27-9-3-10-28-21)4-1-5-14(19)22-30-18(38-31-22)12-32-11-2-6-15-20(32)25(37)33(24(15)36)16-7-8-17(34)29-23(16)35/h1,3-5,9-10,16H,2,6-8,11-12H2,(H,29,34,35) |
| InChIKey | WNIXWGMFPNNNIN-UHFFFAOYSA-N |
| XLogP | 1.87 |
| TPSA | 151.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 533.93 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|