C21H18ClN5O5 — CID 178100840
1-[[3-(2-chlorophenyl)-1,2,4-oxadiazol-5-yl]methyl]-6-(2,6-dioxopiperidin-3-yl)-3,4-dihydro-2H-pyrrolo[3,4-b]pyridine-5,7-dione (PubChem CID 178100840) has the molecular formula C21H18ClN5O5 and a molecular weight of 455.86 g/mol. Its IUPAC name is 1-[[3-(2-chlorophenyl)-1,2,4-oxadiazol-5-yl]methyl]-6-(2,6-dioxopiperidin-3-yl)-3,4-dihydro-2H-pyrrolo[3,4-b]pyridine-5,7-dione.
| Compound Name | 1-[[3-(2-chlorophenyl)-1,2,4-oxadiazol-5-yl]methyl]-6-(2,6-dioxopiperidin-3-yl)-3,4-dihydro-2H-pyrrolo[3,4-b]pyridine-5,7-dione |
|---|---|
| PubChem CID | 178100840 |
| Molecular Formula | C21H18ClN5O5 |
| Molecular Weight | 455.86 g/mol |
| Exact Mass | 455.10 |
| IUPAC Name | 1-[[3-(2-chlorophenyl)-1,2,4-oxadiazol-5-yl]methyl]-6-(2,6-dioxopiperidin-3-yl)-3,4-dihydro-2H-pyrrolo[3,4-b]pyridine-5,7-dione |
| SMILES | O=C1CCC(N2C(=O)C3=C(C2=O)N(Cc2nc(-c4ccccc4Cl)no2)CCC3)C(=O)N1 |
| InChI | InChI=1S/C21H18ClN5O5/c22-13-6-2-1-4-11(13)18-24-16(32-25-18)10-26-9-3-5-12-17(26)21(31)27(20(12)30)14-7-8-15(28)23-19(14)29/h1-2,4,6,14H,3,5,7-10H2,(H,23,28,29) |
| InChIKey | IIOZFOMLCGKXCU-UHFFFAOYSA-N |
| XLogP | 1.41 |
| TPSA | 125.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.86 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|