C25H22FN7O5 — CID 178101098
6-(2,6-dioxopiperidin-3-yl)-1-[[3-[2-fluoro-3-(2-methylpyrazol-3-yl)phenyl]-1,2,4-oxadiazol-5-yl]methyl]-3,4-dihydro-2H-pyrrolo[3,4-b]pyridine-5,7-dione (PubChem CID 178101098) has the molecular formula C25H22FN7O5 and a molecular weight of 519.49 g/mol. Its IUPAC name is 6-(2,6-dioxopiperidin-3-yl)-1-[[3-[2-fluoro-3-(2-methylpyrazol-3-yl)phenyl]-1,2,4-oxadiazol-5-yl]methyl]-3,4-dihydro-2H-pyrrolo[3,4-b]pyridine-5,7-dione.
| Compound Name | 6-(2,6-dioxopiperidin-3-yl)-1-[[3-[2-fluoro-3-(2-methylpyrazol-3-yl)phenyl]-1,2,4-oxadiazol-5-yl]methyl]-3,4-dihydro-2H-pyrrolo[3,4-b]pyridine-5,7-dione |
|---|---|
| PubChem CID | 178101098 |
| Molecular Formula | C25H22FN7O5 |
| Molecular Weight | 519.49 g/mol |
| Exact Mass | 519.17 |
| IUPAC Name | 6-(2,6-dioxopiperidin-3-yl)-1-[[3-[2-fluoro-3-(2-methylpyrazol-3-yl)phenyl]-1,2,4-oxadiazol-5-yl]methyl]-3,4-dihydro-2H-pyrrolo[3,4-b]pyridine-5,7-dione |
| SMILES | Cn1nccc1-c1cccc(-c2noc(CN3CCCC4=C3C(=O)N(C3CCC(=O)NC3=O)C4=O)n2)c1F |
| InChI | InChI=1S/C25H22FN7O5/c1-31-16(9-10-27-31)13-4-2-5-14(20(13)26)22-29-19(38-30-22)12-32-11-3-6-15-21(32)25(37)33(24(15)36)17-7-8-18(34)28-23(17)35/h2,4-5,9-10,17H,3,6-8,11-12H2,1H3,(H,28,34,35) |
| InChIKey | RCXRUGKVYIJNLO-UHFFFAOYSA-N |
| XLogP | 1.30 |
| TPSA | 143.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 519.49 |
| LogP ≤ 5 | 1.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|