C27H24N4O4 — CID 175659335
2-(2,6-dioxopiperidin-3-yl)-5-[3-[2-(pyridin-3-ylmethylamino)ethyl]phenyl]isoindole-1,3-dione (PubChem CID 175659335) has the molecular formula C27H24N4O4 and a molecular weight of 468.51 g/mol. Its IUPAC name is 2-(2,6-dioxopiperidin-3-yl)-5-[3-[2-(pyridin-3-ylmethylamino)ethyl]phenyl]isoindole-1,3-dione.
| Compound Name | 2-(2,6-dioxopiperidin-3-yl)-5-[3-[2-(pyridin-3-ylmethylamino)ethyl]phenyl]isoindole-1,3-dione |
|---|---|
| PubChem CID | 175659335 |
| Molecular Formula | C27H24N4O4 |
| Molecular Weight | 468.51 g/mol |
| Exact Mass | 468.18 |
| IUPAC Name | 2-(2,6-dioxopiperidin-3-yl)-5-[3-[2-(pyridin-3-ylmethylamino)ethyl]phenyl]isoindole-1,3-dione |
| SMILES | O=C1CCC(N2C(=O)c3ccc(-c4cccc(CCNCc5cccnc5)c4)cc3C2=O)C(=O)N1 |
| InChI | InChI=1S/C27H24N4O4/c32-24-9-8-23(25(33)30-24)31-26(34)21-7-6-20(14-22(21)27(31)35)19-5-1-3-17(13-19)10-12-29-16-18-4-2-11-28-15-18/h1-7,11,13-15,23,29H,8-10,12,16H2,(H,30,32,33) |
| InChIKey | LCDLLMYTKHOBIL-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 108.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.51 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|