C19H17N5O4 — CID 167733333
5-[[(2-amino-3-pyridinyl)amino]methyl]-2-(2,6-dioxopiperidin-3-yl)isoindole-1,3-dione (PubChem CID 167733333) has the molecular formula C19H17N5O4 and a molecular weight of 379.38 g/mol. Its IUPAC name is 5-[[(2-amino-3-pyridinyl)amino]methyl]-2-(2,6-dioxopiperidin-3-yl)isoindole-1,3-dione.
| Compound Name | 5-[[(2-amino-3-pyridinyl)amino]methyl]-2-(2,6-dioxopiperidin-3-yl)isoindole-1,3-dione |
|---|---|
| PubChem CID | 167733333 |
| Molecular Formula | C19H17N5O4 |
| Molecular Weight | 379.38 g/mol |
| Exact Mass | 379.13 |
| IUPAC Name | 5-[[(2-amino-3-pyridinyl)amino]methyl]-2-(2,6-dioxopiperidin-3-yl)isoindole-1,3-dione |
| SMILES | Nc1ncccc1NCc1ccc2c(c1)C(=O)N(C1CCC(=O)NC1=O)C2=O |
| InChI | InChI=1S/C19H17N5O4/c20-16-13(2-1-7-21-16)22-9-10-3-4-11-12(8-10)19(28)24(18(11)27)14-5-6-15(25)23-17(14)26/h1-4,7-8,14,22H,5-6,9H2,(H2,20,21)(H,23,25,26) |
| InChIKey | WYNOPVLLCSKTIY-UHFFFAOYSA-N |
| XLogP | 0.68 |
| TPSA | 134.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.38 |
| LogP ≤ 5 | 0.68 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|