C23H20F2N4O4 — CID 167720617
5-[[2-(1-amino-2,2-difluorocyclopropyl)anilino]methyl]-2-(2,6-dioxopiperidin-3-yl)isoindole-1,3-dione (PubChem CID 167720617) has the molecular formula C23H20F2N4O4 and a molecular weight of 454.43 g/mol. Its IUPAC name is 5-[[2-(1-amino-2,2-difluorocyclopropyl)anilino]methyl]-2-(2,6-dioxopiperidin-3-yl)isoindole-1,3-dione.
| Compound Name | 5-[[2-(1-amino-2,2-difluorocyclopropyl)anilino]methyl]-2-(2,6-dioxopiperidin-3-yl)isoindole-1,3-dione |
|---|---|
| PubChem CID | 167720617 |
| Molecular Formula | C23H20F2N4O4 |
| Molecular Weight | 454.43 g/mol |
| Exact Mass | 454.15 |
| IUPAC Name | 5-[[2-(1-amino-2,2-difluorocyclopropyl)anilino]methyl]-2-(2,6-dioxopiperidin-3-yl)isoindole-1,3-dione |
| SMILES | NC1(c2ccccc2NCc2ccc3c(c2)C(=O)N(C2CCC(=O)NC2=O)C3=O)CC1(F)F |
| InChI | InChI=1S/C23H20F2N4O4/c24-23(25)11-22(23,26)15-3-1-2-4-16(15)27-10-12-5-6-13-14(9-12)21(33)29(20(13)32)17-7-8-18(30)28-19(17)31/h1-6,9,17,27H,7-8,10-11,26H2,(H,28,30,31) |
| InChIKey | VVIIZAZDQZKIAA-UHFFFAOYSA-N |
| XLogP | 1.89 |
| TPSA | 121.60 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.43 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|