C21H22N6O4 — CID 167731006
2-(2,6-dioxopiperidin-3-yl)-5-[(6,7,8,9-tetrahydro-5H-imidazo[1,2-d][1,4]diazepin-3-ylamino)methyl]isoindole-1,3-dione (PubChem CID 167731006) has the molecular formula C21H22N6O4 and a molecular weight of 422.45 g/mol. Its IUPAC name is 2-(2,6-dioxopiperidin-3-yl)-5-[(6,7,8,9-tetrahydro-5H-imidazo[1,2-d][1,4]diazepin-3-ylamino)methyl]isoindole-1,3-dione.
| Compound Name | 2-(2,6-dioxopiperidin-3-yl)-5-[(6,7,8,9-tetrahydro-5H-imidazo[1,2-d][1,4]diazepin-3-ylamino)methyl]isoindole-1,3-dione |
|---|---|
| PubChem CID | 167731006 |
| Molecular Formula | C21H22N6O4 |
| Molecular Weight | 422.45 g/mol |
| Exact Mass | 422.17 |
| IUPAC Name | 2-(2,6-dioxopiperidin-3-yl)-5-[(6,7,8,9-tetrahydro-5H-imidazo[1,2-d][1,4]diazepin-3-ylamino)methyl]isoindole-1,3-dione |
| SMILES | O=C1CCC(N2C(=O)c3ccc(CNc4cnc5n4CCNCC5)cc3C2=O)C(=O)N1 |
| InChI | InChI=1S/C21H22N6O4/c28-18-4-3-15(19(29)25-18)27-20(30)13-2-1-12(9-14(13)21(27)31)10-23-17-11-24-16-5-6-22-7-8-26(16)17/h1-2,9,11,15,22-23H,3-8,10H2,(H,25,28,29) |
| InChIKey | WTYCLRJQHZOYRC-UHFFFAOYSA-N |
| XLogP | 0.04 |
| TPSA | 125.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.45 |
| LogP ≤ 5 | 0.04 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|