C22H23N5O5 — CID 167718274
2-(2,6-dioxopiperidin-3-yl)-5-[[(4-piperidin-4-yl-1,3-oxazol-2-yl)amino]methyl]isoindole-1,3-dione (PubChem CID 167718274) has the molecular formula C22H23N5O5 and a molecular weight of 437.46 g/mol. Its IUPAC name is 2-(2,6-dioxopiperidin-3-yl)-5-[[(4-piperidin-4-yl-1,3-oxazol-2-yl)amino]methyl]isoindole-1,3-dione.
| Compound Name | 2-(2,6-dioxopiperidin-3-yl)-5-[[(4-piperidin-4-yl-1,3-oxazol-2-yl)amino]methyl]isoindole-1,3-dione |
|---|---|
| PubChem CID | 167718274 |
| Molecular Formula | C22H23N5O5 |
| Molecular Weight | 437.46 g/mol |
| Exact Mass | 437.17 |
| IUPAC Name | 2-(2,6-dioxopiperidin-3-yl)-5-[[(4-piperidin-4-yl-1,3-oxazol-2-yl)amino]methyl]isoindole-1,3-dione |
| SMILES | O=C1CCC(N2C(=O)c3ccc(CNc4nc(C5CCNCC5)co4)cc3C2=O)C(=O)N1 |
| InChI | InChI=1S/C22H23N5O5/c28-18-4-3-17(19(29)26-18)27-20(30)14-2-1-12(9-15(14)21(27)31)10-24-22-25-16(11-32-22)13-5-7-23-8-6-13/h1-2,9,11,13,17,23H,3-8,10H2,(H,24,25)(H,26,28,29) |
| InChIKey | VPZKRHKSWAEQBJ-UHFFFAOYSA-N |
| XLogP | 1.15 |
| TPSA | 133.64 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.46 |
| LogP ≤ 5 | 1.15 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|