C20H20N4O4 — CID 159320213
2-(2,6-dioxopiperidin-3-yl)-4-(pyridin-3-ylmethylamino)isoindole-1,3-dione;methane (PubChem CID 159320213) has the molecular formula C20H20N4O4 and a molecular weight of 380.40 g/mol. Its IUPAC name is 2-(2,6-dioxopiperidin-3-yl)-4-(pyridin-3-ylmethylamino)isoindole-1,3-dione;methane.
| Compound Name | 2-(2,6-dioxopiperidin-3-yl)-4-(pyridin-3-ylmethylamino)isoindole-1,3-dione;methane |
|---|---|
| PubChem CID | 159320213 |
| Molecular Formula | C20H20N4O4 |
| Molecular Weight | 380.40 g/mol |
| Exact Mass | 380.15 |
| IUPAC Name | 2-(2,6-dioxopiperidin-3-yl)-4-(pyridin-3-ylmethylamino)isoindole-1,3-dione;methane |
| SMILES | C.O=C1CCC(N2C(=O)c3cccc(NCc4cccnc4)c3C2=O)C(=O)N1 |
| InChI | InChI=1S/C19H16N4O4.CH4/c24-15-7-6-14(17(25)22-15)23-18(26)12-4-1-5-13(16(12)19(23)27)21-10-11-3-2-8-20-9-11;/h1-5,8-9,14,21H,6-7,10H2,(H,22,24,25);1H4 |
| InChIKey | LDQXWCCFZBEHFS-UHFFFAOYSA-N |
| XLogP | 1.73 |
| TPSA | 108.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.40 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|