C23H25ClN6O4 — CID 139535692
4-[[1-(1-chloro-4-methylpiperidin-4-yl)pyrazol-4-yl]methylamino]-2-(2,6-dioxopiperidin-3-yl)isoindole-1,3-dione (PubChem CID 139535692) has the molecular formula C23H25ClN6O4 and a molecular weight of 484.94 g/mol. Its IUPAC name is 4-[[1-(1-chloro-4-methylpiperidin-4-yl)pyrazol-4-yl]methylamino]-2-(2,6-dioxopiperidin-3-yl)isoindole-1,3-dione.
| Compound Name | 4-[[1-(1-chloro-4-methylpiperidin-4-yl)pyrazol-4-yl]methylamino]-2-(2,6-dioxopiperidin-3-yl)isoindole-1,3-dione |
|---|---|
| PubChem CID | 139535692 |
| Molecular Formula | C23H25ClN6O4 |
| Molecular Weight | 484.94 g/mol |
| Exact Mass | 484.16 |
| IUPAC Name | 4-[[1-(1-chloro-4-methylpiperidin-4-yl)pyrazol-4-yl]methylamino]-2-(2,6-dioxopiperidin-3-yl)isoindole-1,3-dione |
| SMILES | CC1(n2cc(CNc3cccc4c3C(=O)N(C3CCC(=O)NC3=O)C4=O)cn2)CCN(Cl)CC1 |
| InChI | InChI=1S/C23H25ClN6O4/c1-23(7-9-28(24)10-8-23)29-13-14(12-26-29)11-25-16-4-2-3-15-19(16)22(34)30(21(15)33)17-5-6-18(31)27-20(17)32/h2-4,12-13,17,25H,5-11H2,1H3,(H,27,31,32) |
| InChIKey | NKHFPYKVDRQJJO-UHFFFAOYSA-N |
| XLogP | 1.86 |
| TPSA | 116.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.94 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'N-halo', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|