C30H35N5O4 — CID 163834216
5-[cyclobutylmethyl-[(1S,2S)-2-(pyridin-3-ylmethylamino)cyclohexyl]amino]-2-(2,6-dioxopiperidin-3-yl)isoindole-1,3-dione (PubChem CID 163834216) has the molecular formula C30H35N5O4 and a molecular weight of 529.64 g/mol. Its IUPAC name is 5-[cyclobutylmethyl-[(1S,2S)-2-(pyridin-3-ylmethylamino)cyclohexyl]amino]-2-(2,6-dioxopiperidin-3-yl)isoindole-1,3-dione.
| Compound Name | 5-[cyclobutylmethyl-[(1S,2S)-2-(pyridin-3-ylmethylamino)cyclohexyl]amino]-2-(2,6-dioxopiperidin-3-yl)isoindole-1,3-dione |
|---|---|
| PubChem CID | 163834216 |
| Molecular Formula | C30H35N5O4 |
| Molecular Weight | 529.64 g/mol |
| Exact Mass | 529.27 |
| IUPAC Name | 5-[cyclobutylmethyl-[(1S,2S)-2-(pyridin-3-ylmethylamino)cyclohexyl]amino]-2-(2,6-dioxopiperidin-3-yl)isoindole-1,3-dione |
| SMILES | O=C1CCC(N2C(=O)c3ccc(N(CC4CCC4)[C@H]4CCCC[C@@H]4NCc4cccnc4)cc3C2=O)C(=O)N1 |
| InChI | InChI=1S/C30H35N5O4/c36-27-13-12-26(28(37)33-27)35-29(38)22-11-10-21(15-23(22)30(35)39)34(18-19-5-3-6-19)25-9-2-1-8-24(25)32-17-20-7-4-14-31-16-20/h4,7,10-11,14-16,19,24-26,32H,1-3,5-6,8-9,12-13,17-18H2,(H,33,36,37)/t24-,25-,26?/m0/s1 |
| InChIKey | OGHHEARXYKJCKT-NPGWBMRXSA-N |
| XLogP | 3.19 |
| TPSA | 111.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 529.64 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|