C22H28N4O4 — CID 166865135
5-[[(1S,2R)-2-(diethylamino)cyclopentyl]amino]-2-(2,6-dioxopiperidin-3-yl)isoindole-1,3-dione (PubChem CID 166865135) has the molecular formula C22H28N4O4 and a molecular weight of 412.49 g/mol. Its IUPAC name is 5-[[(1S,2R)-2-(diethylamino)cyclopentyl]amino]-2-(2,6-dioxopiperidin-3-yl)isoindole-1,3-dione.
| Compound Name | 5-[[(1S,2R)-2-(diethylamino)cyclopentyl]amino]-2-(2,6-dioxopiperidin-3-yl)isoindole-1,3-dione |
|---|---|
| PubChem CID | 166865135 |
| Molecular Formula | C22H28N4O4 |
| Molecular Weight | 412.49 g/mol |
| Exact Mass | 412.21 |
| IUPAC Name | 5-[[(1S,2R)-2-(diethylamino)cyclopentyl]amino]-2-(2,6-dioxopiperidin-3-yl)isoindole-1,3-dione |
| SMILES | CCN(CC)[C@@H]1CCC[C@@H]1Nc1ccc2c(c1)C(=O)N(C1CCC(=O)NC1=O)C2=O |
| InChI | InChI=1S/C22H28N4O4/c1-3-25(4-2)17-7-5-6-16(17)23-13-8-9-14-15(12-13)22(30)26(21(14)29)18-10-11-19(27)24-20(18)28/h8-9,12,16-18,23H,3-7,10-11H2,1-2H3,(H,24,27,28)/t16-,17+,18?/m0/s1 |
| InChIKey | FGRLZOSOMLORRF-MYFVLZFPSA-N |
| XLogP | 1.76 |
| TPSA | 98.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.49 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|