C23H29N5O4 — CID 155358249
5-[3-[3-(diethylamino)azetidin-1-yl]azetidin-1-yl]-2-(2,6-dioxopiperidin-3-yl)isoindole-1,3-dione (PubChem CID 155358249) has the molecular formula C23H29N5O4 and a molecular weight of 439.52 g/mol. Its IUPAC name is 5-[3-[3-(diethylamino)azetidin-1-yl]azetidin-1-yl]-2-(2,6-dioxopiperidin-3-yl)isoindole-1,3-dione.
| Compound Name | 5-[3-[3-(diethylamino)azetidin-1-yl]azetidin-1-yl]-2-(2,6-dioxopiperidin-3-yl)isoindole-1,3-dione |
|---|---|
| PubChem CID | 155358249 |
| Molecular Formula | C23H29N5O4 |
| Molecular Weight | 439.52 g/mol |
| Exact Mass | 439.22 |
| IUPAC Name | 5-[3-[3-(diethylamino)azetidin-1-yl]azetidin-1-yl]-2-(2,6-dioxopiperidin-3-yl)isoindole-1,3-dione |
| SMILES | CCN(CC)C1CN(C2CN(c3ccc4c(c3)C(=O)N(C3CCC(=O)NC3=O)C4=O)C2)C1 |
| InChI | InChI=1S/C23H29N5O4/c1-3-25(4-2)15-10-27(11-15)16-12-26(13-16)14-5-6-17-18(9-14)23(32)28(22(17)31)19-7-8-20(29)24-21(19)30/h5-6,9,15-16,19H,3-4,7-8,10-13H2,1-2H3,(H,24,29,30) |
| InChIKey | SMTNVAHBXSACGY-UHFFFAOYSA-N |
| XLogP | 0.30 |
| TPSA | 93.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.52 |
| LogP ≤ 5 | 0.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|