C26H26N6O6 — CID 166143157
2-(2,6-dioxopiperidin-3-yl)-5-[4-[1-(4-nitrophenyl)azetidin-3-yl]piperazin-1-yl]isoindole-1,3-dione (PubChem CID 166143157) has the molecular formula C26H26N6O6 and a molecular weight of 518.53 g/mol. Its IUPAC name is 2-(2,6-dioxopiperidin-3-yl)-5-[4-[1-(4-nitrophenyl)azetidin-3-yl]piperazin-1-yl]isoindole-1,3-dione.
| Compound Name | 2-(2,6-dioxopiperidin-3-yl)-5-[4-[1-(4-nitrophenyl)azetidin-3-yl]piperazin-1-yl]isoindole-1,3-dione |
|---|---|
| PubChem CID | 166143157 |
| Molecular Formula | C26H26N6O6 |
| Molecular Weight | 518.53 g/mol |
| Exact Mass | 518.19 |
| IUPAC Name | 2-(2,6-dioxopiperidin-3-yl)-5-[4-[1-(4-nitrophenyl)azetidin-3-yl]piperazin-1-yl]isoindole-1,3-dione |
| SMILES | O=C1CCC(N2C(=O)c3ccc(N4CCN(C5CN(c6ccc([N+](=O)[O-])cc6)C5)CC4)cc3C2=O)C(=O)N1 |
| InChI | InChI=1S/C26H26N6O6/c33-23-8-7-22(24(34)27-23)31-25(35)20-6-5-18(13-21(20)26(31)36)28-9-11-29(12-10-28)19-14-30(15-19)16-1-3-17(4-2-16)32(37)38/h1-6,13,19,22H,7-12,14-15H2,(H,27,33,34) |
| InChIKey | ZBXQIPTXZVIEHE-UHFFFAOYSA-N |
| XLogP | 1.01 |
| TPSA | 136.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.53 |
| LogP ≤ 5 | 1.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|