C26H19N5O5 — CID 178155064
3-[2-oxo-5-[[3-(3-pyridin-3-ylphenyl)-1,2,4-oxadiazol-5-yl]methyl]-1,3-benzoxazol-3-yl]piperidine-2,6-dione (PubChem CID 178155064) has the molecular formula C26H19N5O5 and a molecular weight of 481.47 g/mol. Its IUPAC name is 3-[2-oxo-5-[[3-(3-pyridin-3-ylphenyl)-1,2,4-oxadiazol-5-yl]methyl]-1,3-benzoxazol-3-yl]piperidine-2,6-dione.
| Compound Name | 3-[2-oxo-5-[[3-(3-pyridin-3-ylphenyl)-1,2,4-oxadiazol-5-yl]methyl]-1,3-benzoxazol-3-yl]piperidine-2,6-dione |
|---|---|
| PubChem CID | 178155064 |
| Molecular Formula | C26H19N5O5 |
| Molecular Weight | 481.47 g/mol |
| Exact Mass | 481.14 |
| IUPAC Name | 3-[2-oxo-5-[[3-(3-pyridin-3-ylphenyl)-1,2,4-oxadiazol-5-yl]methyl]-1,3-benzoxazol-3-yl]piperidine-2,6-dione |
| SMILES | O=C1CCC(n2c(=O)oc3ccc(Cc4nc(-c5cccc(-c6cccnc6)c5)no4)cc32)C(=O)N1 |
| InChI | InChI=1S/C26H19N5O5/c32-22-9-7-19(25(33)28-22)31-20-11-15(6-8-21(20)35-26(31)34)12-23-29-24(30-36-23)17-4-1-3-16(13-17)18-5-2-10-27-14-18/h1-6,8,10-11,13-14,19H,7,9,12H2,(H,28,32,33) |
| InChIKey | YBKJSCTVYHQIGC-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 133.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.47 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|