C21H17N5O6 — CID 178155167
3-[5-[[3-(4-methoxy-3-pyridinyl)-1,2,4-oxadiazol-5-yl]methyl]-2-oxo-1,3-benzoxazol-3-yl]piperidine-2,6-dione (PubChem CID 178155167) has the molecular formula C21H17N5O6 and a molecular weight of 435.40 g/mol. Its IUPAC name is 3-[5-[[3-(4-methoxy-3-pyridinyl)-1,2,4-oxadiazol-5-yl]methyl]-2-oxo-1,3-benzoxazol-3-yl]piperidine-2,6-dione.
| Compound Name | 3-[5-[[3-(4-methoxy-3-pyridinyl)-1,2,4-oxadiazol-5-yl]methyl]-2-oxo-1,3-benzoxazol-3-yl]piperidine-2,6-dione |
|---|---|
| PubChem CID | 178155167 |
| Molecular Formula | C21H17N5O6 |
| Molecular Weight | 435.40 g/mol |
| Exact Mass | 435.12 |
| IUPAC Name | 3-[5-[[3-(4-methoxy-3-pyridinyl)-1,2,4-oxadiazol-5-yl]methyl]-2-oxo-1,3-benzoxazol-3-yl]piperidine-2,6-dione |
| SMILES | COc1ccncc1-c1noc(Cc2ccc3oc(=O)n(C4CCC(=O)NC4=O)c3c2)n1 |
| InChI | InChI=1S/C21H17N5O6/c1-30-15-6-7-22-10-12(15)19-24-18(32-25-19)9-11-2-4-16-14(8-11)26(21(29)31-16)13-3-5-17(27)23-20(13)28/h2,4,6-8,10,13H,3,5,9H2,1H3,(H,23,27,28) |
| InChIKey | XSBPEQRNQIVINL-UHFFFAOYSA-N |
| XLogP | 1.62 |
| TPSA | 142.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.40 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|