C20H15N5O5 — CID 178155074
3-[2-oxo-6-[(3-phenyl-1,2,4-oxadiazol-5-yl)methyl]-[1,3]oxazolo[5,4-b]pyridin-1-yl]piperidine-2,6-dione (PubChem CID 178155074) has the molecular formula C20H15N5O5 and a molecular weight of 405.37 g/mol. Its IUPAC name is 3-[2-oxo-6-[(3-phenyl-1,2,4-oxadiazol-5-yl)methyl]-[1,3]oxazolo[5,4-b]pyridin-1-yl]piperidine-2,6-dione.
| Compound Name | 3-[2-oxo-6-[(3-phenyl-1,2,4-oxadiazol-5-yl)methyl]-[1,3]oxazolo[5,4-b]pyridin-1-yl]piperidine-2,6-dione |
|---|---|
| PubChem CID | 178155074 |
| Molecular Formula | C20H15N5O5 |
| Molecular Weight | 405.37 g/mol |
| Exact Mass | 405.11 |
| IUPAC Name | 3-[2-oxo-6-[(3-phenyl-1,2,4-oxadiazol-5-yl)methyl]-[1,3]oxazolo[5,4-b]pyridin-1-yl]piperidine-2,6-dione |
| SMILES | O=C1CCC(n2c(=O)oc3ncc(Cc4nc(-c5ccccc5)no4)cc32)C(=O)N1 |
| InChI | InChI=1S/C20H15N5O5/c26-15-7-6-13(18(27)22-15)25-14-8-11(10-21-19(14)29-20(25)28)9-16-23-17(24-30-16)12-4-2-1-3-5-12/h1-5,8,10,13H,6-7,9H2,(H,22,26,27) |
| InChIKey | BCWUYWCKYPFECY-UHFFFAOYSA-N |
| XLogP | 1.61 |
| TPSA | 133.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.37 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|