C22H18N6O6 — CID 178154722
3-[3-[methyl-[[3-[3-(1,2-oxazol-4-yl)phenyl]-1,2,4-oxadiazol-5-yl]methyl]amino]-2,5-dioxopyrrol-1-yl]piperidine-2,6-dione (PubChem CID 178154722) has the molecular formula C22H18N6O6 and a molecular weight of 462.42 g/mol. Its IUPAC name is 3-[3-[methyl-[[3-[3-(1,2-oxazol-4-yl)phenyl]-1,2,4-oxadiazol-5-yl]methyl]amino]-2,5-dioxopyrrol-1-yl]piperidine-2,6-dione.
| Compound Name | 3-[3-[methyl-[[3-[3-(1,2-oxazol-4-yl)phenyl]-1,2,4-oxadiazol-5-yl]methyl]amino]-2,5-dioxopyrrol-1-yl]piperidine-2,6-dione |
|---|---|
| PubChem CID | 178154722 |
| Molecular Formula | C22H18N6O6 |
| Molecular Weight | 462.42 g/mol |
| Exact Mass | 462.13 |
| IUPAC Name | 3-[3-[methyl-[[3-[3-(1,2-oxazol-4-yl)phenyl]-1,2,4-oxadiazol-5-yl]methyl]amino]-2,5-dioxopyrrol-1-yl]piperidine-2,6-dione |
| SMILES | CN(Cc1nc(-c2cccc(-c3cnoc3)c2)no1)C1=CC(=O)N(C2CCC(=O)NC2=O)C1=O |
| InChI | InChI=1S/C22H18N6O6/c1-27(16-8-19(30)28(22(16)32)15-5-6-17(29)24-21(15)31)10-18-25-20(26-34-18)13-4-2-3-12(7-13)14-9-23-33-11-14/h2-4,7-9,11,15H,5-6,10H2,1H3,(H,24,29,31) |
| InChIKey | OSMDGKODUSORTP-UHFFFAOYSA-N |
| XLogP | 0.88 |
| TPSA | 151.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.42 |
| LogP ≤ 5 | 0.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|